EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N2O3S |
| Net Charge | 0 |
| Average Mass | 276.317 |
| Monoisotopic Mass | 276.05686 |
| SMILES | COc1ccc(C(=O)ON=C(C)c2nccs2)cc1 |
| InChI | InChI=1S/C13H12N2O3S/c1-9(12-14-7-8-19-12)15-18-13(16)10-3-5-11(17-2)6-4-10/h3-8H,1-2H3 |
| InChIKey | LZDAJNLKAUTBLD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methoxybenzoic acid [1-(2-thiazolyl)ethylideneamino] ester (CHEBI:92638) is a methoxybenzoic acid (CHEBI:25238) |
| Manual Xrefs | Databases |
|---|---|
| LSM-2797 | LINCS |