EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25ClF3N3O4 |
| Net Charge | 0 |
| Average Mass | 463.884 |
| Monoisotopic Mass | 463.14857 |
| SMILES | CCOC(=O)C1CCN(C(=O)C(C)(C)NC(=O)Nc2ccc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C20H25ClF3N3O4/c1-4-31-16(28)12-7-9-27(10-8-12)17(29)19(2,3)26-18(30)25-15-6-5-13(11-14(15)21)20(22,23)24/h5-6,11-12H,4,7-10H2,1-3H3,(H2,25,26,30) |
| InChIKey | FLLMXFQHYNUDRR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[2-[[[2-chloro-4-(trifluoromethyl)anilino]-oxomethyl]amino]-2-methyl-1-oxopropyl]-4-piperidinecarboxylic acid ethyl ester (CHEBI:92552) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-2689 | LINCS |