EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O4 |
| Net Charge | 0 |
| Average Mass | 196.202 |
| Monoisotopic Mass | 196.07356 |
| SMILES | COC(=O)c1c(C)cc(OC)cc1O |
| InChI | InChI=1S/C10H12O4/c1-6-4-7(13-2)5-8(11)9(6)10(12)14-3/h4-5,11H,1-3H3 |
| InChIKey | PFVPJOAAHSOENR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-4-methoxy-6-methylbenzoic acid methyl ester (CHEBI:92544) is a methoxybenzoic acid (CHEBI:25238) |
| Manual Xrefs | Databases |
|---|---|
| LSM-2680 | LINCS |