EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25Cl2N3O4 |
| Net Charge | 0 |
| Average Mass | 430.332 |
| Monoisotopic Mass | 429.12221 |
| SMILES | CCOC(=O)C1CCN(C(=O)C(C)(C)NC(=O)Nc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C19H25Cl2N3O4/c1-4-28-16(25)12-7-9-24(10-8-12)17(26)19(2,3)23-18(27)22-15-6-5-13(20)11-14(15)21/h5-6,11-12H,4,7-10H2,1-3H3,(H2,22,23,27) |
| InChIKey | WKGQAVHYVHTCRH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[2-[[(2,4-dichloroanilino)-oxomethyl]amino]-2-methyl-1-oxopropyl]-4-piperidinecarboxylic acid ethyl ester (CHEBI:92495) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-2619 | LINCS |