EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32N2O |
| Net Charge | 0 |
| Average Mass | 328.500 |
| Monoisotopic Mass | 328.25146 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4(C)O)[C@@]1(C)Cc1cnnc1C2 |
| InChI | InChI=1S/C21H32N2O/c1-19-11-13-12-22-23-18(13)10-14(19)4-5-15-16(19)6-8-20(2)17(15)7-9-21(20,3)24/h12,14-17,24H,4-11H2,1-3H3,(H,22,23)/t14-,15+,16-,17-,19-,20-,21-/m0/s1 |
| InChIKey | LKAJKIOFIWVMDJ-IYRCEVNGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. anabolic agent A compound which stimulates anabolism and inhibits catabolism. Anabolic agents stimulate the development of muscle mass, strength, and power. androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. anabolic agent A compound which stimulates anabolism and inhibits catabolism. Anabolic agents stimulate the development of muscle mass, strength, and power. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stanozolol (CHEBI:9249) has functional parent oxymetholone (CHEBI:7864) |
| stanozolol (CHEBI:9249) has role anabolic agent (CHEBI:36413) |
| stanozolol (CHEBI:9249) has role androgen (CHEBI:50113) |
| stanozolol (CHEBI:9249) is a 17β-hydroxy steroid (CHEBI:35343) |
| stanozolol (CHEBI:9249) is a anabolic androgenic steroid (CHEBI:50786) |
| stanozolol (CHEBI:9249) is a organic heteropentacyclic compound (CHEBI:38164) |
| stanozolol (CHEBI:9249) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1S,3aS,3bR,5aS,10aS,10bS,12aS)-1,10a,12a-trimethyl-1,2,3,3a,3b,4,5,5a,6,7,10,10a,10b,11,12,12a-hexadecahydrocyclopenta[5,6]naphtho[1,2-f]indazol-1-ol |
| INNs | Source |
|---|---|
| estanozolol | WHO MedNet |
| stanozolol | WHO MedNet |
| stanozolol | WHO MedNet |
| stanozololum | WHO MedNet |
| Synonym | Source |
|---|---|
| Androstanazole | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Stromba | ChEBI |
| Strombaject | ChEBI |
| Winstrol | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 2477 | DrugCentral |
| C07311 | KEGG COMPOUND |
| D00444 | KEGG DRUG |
| DB06718 | DrugBank |
| HMDB0003116 | HMDB |
| Stanozolol | Wikipedia |
| US3030358 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8359772 | Reaxys |
| CAS:10418-03-8 | KEGG COMPOUND |
| CAS:10418-03-8 | ChemIDplus |
| CAS:10418-03-8 | NIST Chemistry WebBook |
| Citations |
|---|