EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2O2 |
| Net Charge | 0 |
| Average Mass | 272.348 |
| Monoisotopic Mass | 272.15248 |
| SMILES | O=C(OCCN1CCCCC1)c1cnc2ccccc12 |
| InChI | InChI=1S/C16H20N2O2/c19-16(20-11-10-18-8-4-1-5-9-18)14-12-17-15-7-3-2-6-13(14)15/h2-3,6-7,12,17H,1,4-5,8-11H2 |
| InChIKey | YGKPIROTKVQCCU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1H-indole-3-carboxylic acid 2-(1-piperidinyl)ethyl ester (CHEBI:92477) is a indolyl carboxylic acid (CHEBI:46867) |
| Manual Xrefs | Databases |
|---|---|
| LSM-2594 | LINCS |