EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20ClN3O6S2 |
| Net Charge | 0 |
| Average Mass | 473.960 |
| Monoisotopic Mass | 473.04821 |
| SMILES | [H][C@]12N(C)c3c(cc(Cl)c(OC)c3OC)[C@@]1(O)[C@@H](O)[C@]13SS[C@](C)(C(=O)N21)N(C)C3=O |
| InChI | InChI=1S/C18H20ClN3O6S2/c1-16-14(24)22-13-17(26,12(23)18(22,30-29-16)15(25)21(16)3)7-6-8(19)10(27-4)11(28-5)9(7)20(13)2/h6,12-13,23,26H,1-5H3/t12-,13-,16-,17-,18-/m1/s1 |
| InChIKey | QTONANGUNATZOU-ICTVWZTPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Delitschia sp. (ncbitaxon:2012369) | - | PubMed (30016827) | Strain: G858 |
| Pithomyces chartarum (ncbitaxon:1547544) | - | PubMed (16031836) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Wnt signalling activator A substance that activates any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. mycotoxin Poisonous substance produced by fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sporidesmin A (CHEBI:9243) has role mycotoxin (CHEBI:25442) |
| sporidesmin A (CHEBI:9243) has role Wnt signalling activator (CHEBI:131492) |
| sporidesmin A (CHEBI:9243) is a aromatic ether (CHEBI:35618) |
| sporidesmin A (CHEBI:9243) is a cyclic ketone (CHEBI:3992) |
| sporidesmin A (CHEBI:9243) is a diketone (CHEBI:46640) |
| sporidesmin A (CHEBI:9243) is a organic disulfide (CHEBI:35489) |
| sporidesmin A (CHEBI:9243) is a organic heteropentacyclic compound (CHEBI:38164) |
| sporidesmin A (CHEBI:9243) is a organochlorine compound (CHEBI:36683) |
| sporidesmin A (CHEBI:9243) is a secondary alcohol (CHEBI:35681) |
| sporidesmin A (CHEBI:9243) is a tertiary alcohol (CHEBI:26878) |
| sporidesmin A (CHEBI:9243) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (3R,5aR,10bS,11R,11aR)-9-chloro-10b,11-dihydroxy-7,8-dimethoxy-2,3,6-trimethyl-2,3,5a,6,10b,11-hexahydro-3,11a-epidithiopyrazino[1',2':1,5]pyrrolo[2,3-b]indole-1,4-dione |
| Synonyms | Source |
|---|---|
| (3R,5aR,10bS,11R,11aR)-9-Chloro-2,3,5a,6,10b,11-hexahydro-10b,11-dihydroxy-7,8-dimethoxy-2,3,6-trimethyl-3,11a-epidithio-11aH-pyrazino[1',2':1,5]pyrrolo[2,3-b]indole-1,4-dione | ChEBI |
| hydroxysporidesmin B | ChemIDplus |
| sporidesmin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 89980 | ChemSpider |
| C00002363 | KNApSAcK |
| C10618 | KEGG COMPOUND |
| HMDB0258439 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1456-55-9 | ChemIDplus |
| Citations |
|---|