EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H35NO2 |
| Net Charge | 0 |
| Average Mass | 297.483 |
| Monoisotopic Mass | 297.26678 |
| SMILES | CCCN(CC)CC1COC2(CCC(C(C)(C)C)CC2)O1 |
| InChI | InChI=1S/C18H35NO2/c1-6-12-19(7-2)13-16-14-20-18(21-16)10-8-15(9-11-18)17(3,4)5/h15-16H,6-14H2,1-5H3 |
| InChIKey | PUYXTUJWRLOUCW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. sterol biosynthesis inhibitor Any compound that inhibits the biosynthesis of any sterol. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spiroxamine (CHEBI:9242) has role antifungal agrochemical (CHEBI:86328) |
| spiroxamine (CHEBI:9242) has role environmental contaminant (CHEBI:78298) |
| spiroxamine (CHEBI:9242) has role sterol biosynthesis inhibitor (CHEBI:83317) |
| spiroxamine (CHEBI:9242) has role xenobiotic (CHEBI:35703) |
| spiroxamine (CHEBI:9242) is a dioxolane (CHEBI:39430) |
| spiroxamine (CHEBI:9242) is a spiroketal (CHEBI:72600) |
| spiroxamine (CHEBI:9242) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-[(8-tert-butyl-1,4-dioxaspiro[4.5]dec-2-yl)methyl]-N-ethylpropan-1-amine |
| Synonyms | Source |
|---|---|
| 8-(1,1-dimethylethyl)-N-ethyl-N-propyl-1,4-dioxaspiro(4.5)decane-2-methanamine | ChEBI |
| (8-tert-Butyl-1,4-dioxa-spiro[4.5]dec-2-ylmethyl)-ethyl-propyl-amine | ChEMBL |
| KWG4168 | KEGG COMPOUND |
| Spiroxamine | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Impulse | ChEBI |
| Prosper | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 599 | PPDB |
| C11124 | KEGG COMPOUND |
| DE3735555 | Patent |
| spiroxamine | Alan Wood's Pesticides |
| US4851405 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11342560 | Reaxys |
| CAS:118134-30-8 | KEGG COMPOUND |
| CAS:118134-30-8 | ChemIDplus |
| Citations |
|---|