EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H35NO2 |
| Net Charge | 0 |
| Average Mass | 297.483 |
| Monoisotopic Mass | 297.26678 |
| SMILES | CCCN(CC)CC1COC2(CCC(C(C)(C)C)CC2)O1 |
| InChI | InChI=1S/C18H35NO2/c1-6-12-19(7-2)13-16-14-20-18(21-16)10-8-15(9-11-18)17(3,4)5/h15-16H,6-14H2,1-5H3 |
| InChIKey | PUYXTUJWRLOUCW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. sterol biosynthesis inhibitor Any compound that inhibits the biosynthesis of any sterol. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spiroxamine (CHEBI:9242) has role antifungal agrochemical (CHEBI:86328) |
| spiroxamine (CHEBI:9242) has role environmental contaminant (CHEBI:78298) |
| spiroxamine (CHEBI:9242) has role sterol biosynthesis inhibitor (CHEBI:83317) |
| spiroxamine (CHEBI:9242) has role xenobiotic (CHEBI:35703) |
| spiroxamine (CHEBI:9242) is a dioxolane (CHEBI:39430) |
| spiroxamine (CHEBI:9242) is a spiroketal (CHEBI:72600) |
| spiroxamine (CHEBI:9242) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-[(8-tert-butyl-1,4-dioxaspiro[4.5]dec-2-yl)methyl]-N-ethylpropan-1-amine |
| Synonyms | Source |
|---|---|
| 8-(1,1-dimethylethyl)-N-ethyl-N-propyl-1,4-dioxaspiro(4.5)decane-2-methanamine | ChEBI |
| (8-tert-Butyl-1,4-dioxa-spiro[4.5]dec-2-ylmethyl)-ethyl-propyl-amine | ChEMBL |
| KWG4168 | KEGG COMPOUND |
| Spiroxamine | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Impulse | ChEBI |
| Prosper | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 599 | PPDB |
| C11124 | KEGG COMPOUND |
| DE3735555 | Patent |
| spiroxamine | Alan Wood's Pesticides |
| US4851405 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11342560 | Reaxys |
| CAS:118134-30-8 | KEGG COMPOUND |
| CAS:118134-30-8 | ChemIDplus |
| Citations |
|---|