EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O4S |
| Net Charge | 0 |
| Average Mass | 416.583 |
| Monoisotopic Mass | 416.20213 |
| SMILES | [H][C@]12CC[C@]3(C)[C@]4(CCC(=O)O4)CC[C@@]3([H])[C@]1([H])[C@H](SC(C)=O)CC1=CC(=O)CC[C@@]12C |
| InChI | InChI=1S/C24H32O4S/c1-14(25)29-19-13-15-12-16(26)4-8-22(15,2)17-5-9-23(3)18(21(17)19)6-10-24(23)11-7-20(27)28-24/h12,17-19,21H,4-11,13H2,1-3H3/t17-,18-,19+,21+,22-,23-,24+/m0/s1 |
| InChIKey | LXMSZDCAJNLERA-ZHYRCANASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. aldosterone antagonist A compound which inhibits or antagonizes the biosynthesis or actions of aldosterone. |
| Applications: | diuretic An agent that promotes the excretion of urine through its effects on kidney function. aldosterone antagonist A compound which inhibits or antagonizes the biosynthesis or actions of aldosterone. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spironolactone (CHEBI:9241) has role aldosterone antagonist (CHEBI:50844) |
| spironolactone (CHEBI:9241) has role antihypertensive agent (CHEBI:35674) |
| spironolactone (CHEBI:9241) has role diuretic (CHEBI:35498) |
| spironolactone (CHEBI:9241) has role environmental contaminant (CHEBI:78298) |
| spironolactone (CHEBI:9241) has role xenobiotic (CHEBI:35703) |
| spironolactone (CHEBI:9241) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| spironolactone (CHEBI:9241) is a oxaspiro compound (CHEBI:37948) |
| spironolactone (CHEBI:9241) is a steroid lactone (CHEBI:26766) |
| spironolactone (CHEBI:9241) is a thioester (CHEBI:51277) |
| IUPAC Name |
|---|
| 7α-(acetylsulfanyl)-3-oxo-17α-pregn-4-ene-21,17-carbolactone |
| INNs | Source |
|---|---|
| espironolactona | ChEBI |
| spironolactone | ChEBI |
| spironolactonum | ChEBI |
| Synonyms | Source |
|---|---|
| Spironolactone | KEGG COMPOUND |
| spironolattone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2475 | DrugCentral |
| C07310 | KEGG COMPOUND |
| D00443 | KEGG DRUG |
| DB00421 | DrugBank |
| HMDB0014565 | HMDB |
| SNL | PDBeChem |
| Spironolactone | Wikipedia |
| US3013012 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:57767 | Reaxys |
| CAS:52-01-7 | ChemIDplus |
| Citations |
|---|