EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H28N2 |
| Net Charge | 0 |
| Average Mass | 392.546 |
| Monoisotopic Mass | 392.22525 |
| SMILES | c1ccc(C(NCCNC(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N2/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)29-21-22-30-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20,27-30H,21-22H2 |
| InChIKey | DTZDSNQYNPNCPK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabotropic glutamate receptor agonist An agonist that selectively binds to and activates a metabotropic glutamate receptor. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N'-bis(diphenylmethyl)ethane-1,2-diamine (CHEBI:92409) has role metabotropic glutamate receptor agonist (CHEBI:61966) |
| N,N'-bis(diphenylmethyl)ethane-1,2-diamine (CHEBI:92409) has role neuroprotective agent (CHEBI:63726) |
| N,N'-bis(diphenylmethyl)ethane-1,2-diamine (CHEBI:92409) is a benzenes (CHEBI:22712) |
| N,N'-bis(diphenylmethyl)ethane-1,2-diamine (CHEBI:92409) is a diamine (CHEBI:23666) |
| N,N'-bis(diphenylmethyl)ethane-1,2-diamine (CHEBI:92409) is a diarylmethane (CHEBI:51614) |
| N,N'-bis(diphenylmethyl)ethane-1,2-diamine (CHEBI:92409) is a secondary amino compound (CHEBI:50995) |
| N,N'-bis(diphenylmethyl)ethane-1,2-diamine (CHEBI:92409) is conjugate base of N,N'-bis(diphenylmethyl)ethane-1,2-diamine(2+) (CHEBI:180501) |
| Incoming Relation(s) |
| N,N'-bis(diphenylmethyl)ethane-1,2-diamine(2+) (CHEBI:180501) is conjugate acid of N,N'-bis(diphenylmethyl)ethane-1,2-diamine (CHEBI:92409) |
| IUPAC Name |
|---|
| N,N'-bis(diphenylmethyl)ethane-1,2-diamine |
| Synonyms | Source |
|---|---|
| N1,N2-bis(diphenylmethyl)ethane-1,2-diamine | IUPAC |
| N,N'-dibenzhydrylethylenediamine | ChEBI |
| N,N'-bis(diphenylmethyl)-1,2-ethanediamine | ChEBI |
| N,N'-dibenzhydryl-1,2-ethanediamine | ChEBI |
| N,N'-dibenzhydrylethane-1,2-diamine | ChEBI |
| AMN082 (free base) | ChEBI |
| Citations |
|---|