EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N4O4S |
| Net Charge | 0 |
| Average Mass | 362.411 |
| Monoisotopic Mass | 362.10488 |
| SMILES | COc1ccccc1C(=O)NNC(=O)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H18N4O4S/c1-23-13-5-3-2-4-11(13)14(21)18-19-15(22)12-10-25-16(17-12)20-6-8-24-9-7-20/h2-5,10H,6-9H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | JTQPAWWMXMKZOP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N'-[(2-methoxyphenyl)-oxomethyl]-2-(4-morpholinyl)-4-thiazolecarbohydrazide (CHEBI:92396) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-2491 | LINCS |