EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16N2O |
| Net Charge | 0 |
| Average Mass | 264.328 |
| Monoisotopic Mass | 264.12626 |
| SMILES | CN(C)c1ccc(C=C2C(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C17H16N2O/c1-19(2)13-9-7-12(8-10-13)11-15-14-5-3-4-6-16(14)18-17(15)20/h3-11H,1-2H3,(H,18,20) |
| InChIKey | UAKWLVYMKBWHMX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SU4312 (CHEBI:92369) has role angiogenesis inhibitor (CHEBI:48422) |
| SU4312 (CHEBI:92369) has role antineoplastic agent (CHEBI:35610) |
| SU4312 (CHEBI:92369) has role geroprotector (CHEBI:176497) |
| SU4312 (CHEBI:92369) has role neuroprotective agent (CHEBI:63726) |
| SU4312 (CHEBI:92369) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| SU4312 (CHEBI:92369) is a oxindoles (CHEBI:38459) |
| SU4312 (CHEBI:92369) is a substituted aniline (CHEBI:48975) |
| SU4312 (CHEBI:92369) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 3-[4-(dimethylamino)benzylidene]-1,3-dihydro-2H-indol-2-one |
| Synonyms | Source |
|---|---|
| 3-(4-dimethylamino-benzylidenyl)-2-indolinone | ChemIDplus |
| 3-[[4-(dimethylamino)phenyl]methylidene]-1H-indol-2-one | LINCS |
| DMBI | ChemIDplus |
| SU 4312 | ChemIDplus |
| SU-4312 | ChEBI |
| Citations |
|---|