EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23NO |
| Net Charge | 0 |
| Average Mass | 269.388 |
| Monoisotopic Mass | 269.17796 |
| SMILES | CNCCCCOc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C18H23NO/c1-19-13-7-8-14-20-18-12-6-5-11-17(18)15-16-9-3-2-4-10-16/h2-6,9-12,19H,7-8,13-15H2,1H3 |
| InChIKey | QSQQPMHPCBLLGX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-4-[2-(phenylmethyl)phenoxy]-1-butanamine (CHEBI:92338) has role antidepressant (CHEBI:35469) |
| N-methyl-4-[2-(phenylmethyl)phenoxy]-1-butanamine (CHEBI:92338) is a diarylmethane (CHEBI:51614) |
| INN | Source |
|---|---|
| bifemelano | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-(o-Benzylphenoxy)-N-methylbutylamine | DrugCentral |
| bifemelane | ChEMBL |
| Bifemelane | ChEMBL |
| bifemelane HCl | DrugCentral |
| bifemelane hydrochloride | DrugCentral |
| Citations |
|---|