EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26FN3O2 |
| Net Charge | 0 |
| Average Mass | 395.478 |
| Monoisotopic Mass | 395.20091 |
| SMILES | O=C(CCCN1CCC2(CC1)C(=O)NCN2c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FN3O2/c24-19-10-8-18(9-11-19)21(28)7-4-14-26-15-12-23(13-16-26)22(29)25-17-27(23)20-5-2-1-3-6-20/h1-3,5-6,8-11H,4,7,12-17H2,(H,25,29) |
| InChIKey | DKGZKTPJOSAWFA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| Applications: | psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spiperone (CHEBI:9233) has role antipsychotic agent (CHEBI:35476) |
| spiperone (CHEBI:9233) has role dopaminergic antagonist (CHEBI:48561) |
| spiperone (CHEBI:9233) has role psychotropic drug (CHEBI:35471) |
| spiperone (CHEBI:9233) has role serotonergic antagonist (CHEBI:48279) |
| spiperone (CHEBI:9233) has role α-adrenergic antagonist (CHEBI:37890) |
| spiperone (CHEBI:9233) is a aromatic ketone (CHEBI:76224) |
| spiperone (CHEBI:9233) is a azaspiro compound (CHEBI:35624) |
| spiperone (CHEBI:9233) is a organofluorine compound (CHEBI:37143) |
| spiperone (CHEBI:9233) is a piperidines (CHEBI:26151) |
| spiperone (CHEBI:9233) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 8-[4-(4-fluorophenyl)-4-oxobutyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| INNs | Source |
|---|---|
| espiperona | ChemIDplus |
| spiperone | ChemIDplus |
| spipérone | WHO MedNet |
| spiperonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-[2-[4-[5-chloro-1-(4-fluorophenyl)-indol-3-yl]-1-piperidyl]ethyl]imidazolidin-2-one | IUPHAR |
| 8-(3-p-fluorobenzoyl-1-propyl)-4-oxo-1-phenyl-1,3,8-triazaspiro(4,5)decane | ChemIDplus |
| 8-(3-(p-fluorobenzoyl)propyl)-1-phenyl-1,3,8-triazaspiro(4.5)decan-4-one | ChemIDplus |
| Brand Name | Source |
|---|---|
| Spiropitan | KEGG DRUG |
| Citations |
|---|