EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17NO5 |
| Net Charge | 0 |
| Average Mass | 327.336 |
| Monoisotopic Mass | 327.11067 |
| SMILES | COc1ccc(C=CC(=O)Nc2ccccc2C(=O)O)cc1OC |
| InChI | InChI=1S/C18H17NO5/c1-23-15-9-7-12(11-16(15)24-2)8-10-17(20)19-14-6-4-3-5-13(14)18(21)22/h3-11H,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | NZHGWWWHIYHZNX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[3-(3,4-dimethoxyphenyl)-1-oxoprop-2-enyl]amino]benzoic acid (CHEBI:92320) has functional parent anthranilic acid (CHEBI:30754) |
| 2-[[3-(3,4-dimethoxyphenyl)-1-oxoprop-2-enyl]amino]benzoic acid (CHEBI:92320) is a amidobenzoic acid (CHEBI:48470) |
| 2-[[3-(3,4-dimethoxyphenyl)-1-oxoprop-2-enyl]amino]benzoic acid (CHEBI:92320) is a cinnamamides (CHEBI:23247) |
| 2-[[3-(3,4-dimethoxyphenyl)-1-oxoprop-2-enyl]amino]benzoic acid (CHEBI:92320) is a secondary carboxamide (CHEBI:140325) |
| Manual Xrefs | Databases |
|---|---|
| LSM-2388 | LINCS |