EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H65NO10 |
| Net Charge | 0 |
| Average Mass | 731.968 |
| Monoisotopic Mass | 731.46085 |
| SMILES | [H][C@@]12C=C3C(=O)[C@H](C)[C@@H](O[C@H]4CC[C@H](N(C)C)[C@@H](C)O4)CCC[C@H](CC)OC(=O)C[C@@]3([H])[C@]1([H])C=C[C@]1([H])C[C@@H](O[C@@H]3O[C@@H](C)[C@H](OC)[C@@H](OC)[C@H]3OC)C[C@@]21[H] |
| InChI | InChI=1S/C41H65NO10/c1-10-26-12-11-13-34(52-36-17-16-33(42(5)6)23(3)48-36)22(2)37(44)32-20-30-28(31(32)21-35(43)50-26)15-14-25-18-27(19-29(25)30)51-41-40(47-9)39(46-8)38(45-7)24(4)49-41/h14-15,20,22-31,33-34,36,38-41H,10-13,16-19,21H2,1-9H3/t22-,23-,24+,25-,26+,27-,28-,29-,30-,31+,33+,34+,36+,38+,39-,40-,41+/m1/s1 |
| InChIKey | SRJQTHAZUNRMPR-UYQKXTDMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | pediculicide Substance used to treat lice (genus Pediculus) infestation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spinosyn A (CHEBI:9230) has role pediculicide (CHEBI:38706) |
| spinosyn A (CHEBI:9230) is a spinosyn (CHEBI:39207) |
| spinosyn A (CHEBI:9230) is a spinosyn insecticide (CHEBI:39210) |
| Incoming Relation(s) |
| spinosad (CHEBI:39211) has part spinosyn A (CHEBI:9230) |
| IUPAC Name |
|---|
| (2R,3aS,5aR,5bS,9S,13S,14R,16aS,16bR)-13-{[(2R,5S,6R)-5-(dimethylamino)-6-methyltetrahydro-2H-pyran-2-yl]oxy}-9-ethyl-14-methyl-7,15-dioxo-2,3,3a,5a,5b,6,7,9,10,11,12,13,14,15,16a,16b-hexadecahydro-1H-as-indaceno[3,2-d]oxacyclododecin-2-yl 6-deoxy-2,3,4-tri-O-methyl-α-L-mannopyranoside |
| Synonyms | Source |
|---|---|
| A 83543A | ChemIDplus |
| lepicidin A | ChemIDplus |
| Spinosad factor A | KEGG COMPOUND |
| Spinosyn A | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11054 | KEGG COMPOUND |
| CPD-13385 | MetaCyc |
| Spinosad | Wikipedia |
| WO2004095926 | Patent |
| WO2006127322 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6838034 | Reaxys |
| CAS:131929-60-7 | KEGG COMPOUND |
| CAS:131929-60-7 | ChemIDplus |
| Citations |
|---|