EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H56O12 |
| Net Charge | 0 |
| Average Mass | 716.865 |
| Monoisotopic Mass | 716.37718 |
| SMILES | [H][C@@]12CC=C3C(C)(C)C(=O)C(O)=C[C@@]3([H])[C@]1(C)CC[C@@]1(C)[C@@]2(C)C[C@@H](O[C@@H]2OC[C@H](OC(C)=O)[C@H](O)[C@H]2OC(C)=O)[C@]1([H])[C@@](C)(O)C(=O)/C=C/C(C)(C)O |
| InChI | InChI=1S/C39H56O12/c1-20(40)49-26-19-48-33(30(29(26)44)50-21(2)41)51-25-18-38(9)27-12-11-22-23(17-24(42)32(45)35(22,5)6)36(27,7)15-16-37(38,8)31(25)39(10,47)28(43)13-14-34(3,4)46/h11,13-14,17,23,25-27,29-31,33,42,44,46-47H,12,15-16,18-19H2,1-10H3/b14-13+/t23-,25-,26+,27-,29+,30-,31+,33+,36+,37-,38+,39+/m1/s1 |
| InChIKey | UODJOGKPOAZZHT-OCCINUARSA-N |
| Roles Classification |
|---|
| Biological Role: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spinoside A (CHEBI:9229) is a cucurbitacin (CHEBI:16219) |
| Spinoside A (CHEBI:9229) is a glycoside (CHEBI:24400) |
| Synonym | Source |
|---|---|
| Spinoside A | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C08809 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:119626-74-3 | KEGG COMPOUND |