EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H27ClF5NO |
| Net Charge | 0 |
| Average Mass | 523.973 |
| Monoisotopic Mass | 523.17013 |
| SMILES | OC1(c2ccc(Cl)c(C(F)(F)F)c2)CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H27ClF5NO/c29-26-12-7-21(18-25(26)28(32,33)34)27(36)13-16-35(17-14-27)15-1-2-24(19-3-8-22(30)9-4-19)20-5-10-23(31)11-6-20/h3-12,18,24,36H,1-2,13-17H2 |
| InChIKey | MDLAAYDRRZXJIF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[4,4-bis(4-fluorophenyl)butyl]-4-[4-chloro-3-(trifluoromethyl)phenyl]-4-piperidinol (CHEBI:92278) has role antipsychotic agent (CHEBI:35476) |
| 1-[4,4-bis(4-fluorophenyl)butyl]-4-[4-chloro-3-(trifluoromethyl)phenyl]-4-piperidinol (CHEBI:92278) is a diarylmethane (CHEBI:51614) |
| Synonyms | Source |
|---|---|
| MCN-JR-16,341 | ChEMBL |
| MCN-JR-16341 | ChEMBL |
| Micefal | ChEMBL |
| NSC-759179 | ChEMBL |
| penfluridol | ChEMBL |
| Penfluridol | ChEMBL |
| Brand Name | Source |
|---|---|
| Semap | ChEMBL |
| Citations |
|---|