EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N2O3 |
| Net Charge | 0 |
| Average Mass | 336.391 |
| Monoisotopic Mass | 336.14739 |
| SMILES | N#CC(=Cc1ccc(O)c(O)c1)C(=O)NCCCCc1ccccc1 |
| InChI | InChI=1S/C20H20N2O3/c21-14-17(12-16-9-10-18(23)19(24)13-16)20(25)22-11-5-4-8-15-6-2-1-3-7-15/h1-3,6-7,9-10,12-13,23-24H,4-5,8,11H2,(H,22,25) |
| InChIKey | GWCNJMUSWLTSCW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-cyano-3-(3,4-dihydroxyphenyl)-N-(4-phenylbutyl)-2-propenamide (CHEBI:92254) is a hydroxycinnamic acid (CHEBI:24689) |
| Manual Xrefs | Databases |
|---|---|
| LSM-2306 | LINCS |