EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22F3N3 |
| Net Charge | 0 |
| Average Mass | 349.400 |
| Monoisotopic Mass | 349.17658 |
| SMILES | Nc1ccc(CCN2CCN(c3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C19H22F3N3/c20-19(21,22)16-2-1-3-18(14-16)25-12-10-24(11-13-25)9-8-15-4-6-17(23)7-5-15/h1-7,14H,8-13,23H2 |
| InChIKey | GAAKALASJNGQKD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LY-165163 (CHEBI:92250) has functional parent 1-(3-(trifluoromethyl)phenyl)piperazine (CHEBI:83536) |
| LY-165163 (CHEBI:92250) has role geroprotector (CHEBI:176497) |
| LY-165163 (CHEBI:92250) has role serotonergic agonist (CHEBI:35941) |
| LY-165163 (CHEBI:92250) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| LY-165163 (CHEBI:92250) is a N-alkylpiperazine (CHEBI:46845) |
| LY-165163 (CHEBI:92250) is a N-arylpiperazine (CHEBI:46848) |
| LY-165163 (CHEBI:92250) is a primary arylamine (CHEBI:50471) |
| LY-165163 (CHEBI:92250) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 4-(2-{4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}ethyl)aniline |
| Synonyms | Source |
|---|---|
| 1-(2-(4-aminophenyl)ethyl)-4-(3-trifluoromethylphenyl)piperazine | ChemIDplus |
| 1-(m-trifluoromethylphenyl)-4-(p-aminophenylethyl)piperazine | ChEBI |
| 4-(2-(4-(3-(trifluoromethyl)phenyl)-1-piperazinyl)ethyl)-benzenamine | ChEBI |
| LY 165,163 | ChEBI |
| LY 165163 | ChemIDplus |
| LY-165,163 | ChEBI |
| Citations |
|---|