EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23N3O5 |
| Net Charge | 0 |
| Average Mass | 397.431 |
| Monoisotopic Mass | 397.16377 |
| SMILES | CN(C)Cc1c(C(=O)NCCOc2ccc(C(=O)NO)cc2)oc2ccccc12 |
| InChI | InChI=1S/C21H23N3O5/c1-24(2)13-17-16-5-3-4-6-18(16)29-19(17)21(26)22-11-12-28-15-9-7-14(8-10-15)20(25)23-27/h3-10,27H,11-13H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | MAUCONCHVWBMHK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abexinostat (CHEBI:92223) has role antineoplastic agent (CHEBI:35610) |
| abexinostat (CHEBI:92223) has role apoptosis inducer (CHEBI:68495) |
| abexinostat (CHEBI:92223) has role autophagy inducer (CHEBI:138880) |
| abexinostat (CHEBI:92223) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| abexinostat (CHEBI:92223) has role radiosensitizing agent (CHEBI:132992) |
| abexinostat (CHEBI:92223) is a 1-benzofurans (CHEBI:38830) |
| abexinostat (CHEBI:92223) is a aromatic ether (CHEBI:35618) |
| abexinostat (CHEBI:92223) is a hydroxamic acid (CHEBI:24650) |
| abexinostat (CHEBI:92223) is a secondary carboxamide (CHEBI:140325) |
| abexinostat (CHEBI:92223) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 3-[(dimethylamino)methyl]-N-{2-[4-(hydroxycarbamoyl)phenoxy]ethyl}-1-benzofuran-2-carboxamide |
| INNs | Source |
|---|---|
| abexinostat | WHO MedNet |
| abexinostat | WHO MedNet |
| abexinostat | WHO MedNet |
| abexinostatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3-[(dimethylamino)methyl]-N-[2-[4-[(hydroxyamino)carbonyl]phenoxy]ethyl]-2-benzofurancarboxamide | ChEBI |
| 3-[(dimethylamino)methyl]-N-[2-[4-[(hydroxyamino)-oxomethyl]phenoxy]ethyl]-2-benzofurancarboxamide | ChEBI |
| 3-[(dimethylamino)methyl]-N-[2-[4-(hydroxycarbamoyl)phenoxy]ethyl]-1-benzofuran-2-carboxamide | ChEBI |
| CRA 024781 | DrugBank |
| CRA-024781 | DrugBank |
| CRA 24781 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| Abexinostat | Wikipedia |
| D10060 | KEGG DRUG |
| DB12565 | DrugBank |
| HMDB0256171 | HMDB |
| LSM-2269 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:783355-60-2 | KEGG DRUG |
| Citations |
|---|