EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12F3N3S |
| Net Charge | 0 |
| Average Mass | 335.354 |
| Monoisotopic Mass | 335.07040 |
| SMILES | N#CC(=C(N)Sc1ccc(N)cc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H12F3N3S/c17-16(18,19)14-4-2-1-3-12(14)13(9-20)15(22)23-11-7-5-10(21)6-8-11/h1-8H,21-22H2 |
| InChIKey | JLOXTZFYJNCPIS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.12.2 (mitogen-activated protein kinase kinase) inhibitor An EC 2.7.12.* [dual-specificity kinases (those acting on Ser/Thr and Tyr residues)] inhibitor that inhibits the action of mitogen-activated protein kinase kinase (EC 2.7.12.2). |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SL-327 (CHEBI:92211) has role EC 2.7.12.2 (mitogen-activated protein kinase kinase) inhibitor (CHEBI:88286) |
| SL-327 (CHEBI:92211) has role neuroprotective agent (CHEBI:63726) |
| SL-327 (CHEBI:92211) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| SL-327 (CHEBI:92211) is a enamine (CHEBI:47989) |
| SL-327 (CHEBI:92211) is a nitrile (CHEBI:18379) |
| SL-327 (CHEBI:92211) is a organic sulfide (CHEBI:16385) |
| SL-327 (CHEBI:92211) is a primary amino compound (CHEBI:50994) |
| SL-327 (CHEBI:92211) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 3-amino-3-[(4-aminophenyl)sulfanyl]-2-[2-(trifluoromethyl)phenyl]acrylonitrile |
| Synonyms | Source |
|---|---|
| SL 327 | ChemIDplus |
| SL327 | ChEBI |
| 3-amino-3-[(4-aminophenyl)thio]-2-[2-(trifluoromethyl)phenyl]-2-propenenitrile | LINCS |
| α-{amino[(4-aminophenyl)thio]methylene}-2-(trifluoromethyl)benzeneacetonitrile | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-2253 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9423720 | Reaxys |
| CAS:305350-87-2 | ChemIDplus |
| Citations |
|---|