EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24Cl2N2O3 |
| Net Charge | 0 |
| Average Mass | 447.362 |
| Monoisotopic Mass | 446.11640 |
| SMILES | COc1ccc2c(c1)c(CCN1CCOCC1)c(C)n2C(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C23H24Cl2N2O3/c1-15-17(8-9-26-10-12-30-13-11-26)19-14-16(29-2)6-7-21(19)27(15)23(28)18-4-3-5-20(24)22(18)25/h3-7,14H,8-13H2,1-2H3 |
| InChIKey | FSFZRNZSZYDVLI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | CB2 receptor agonist A cannabinoid receptor agonist that binds to and activates type 2 cannabinoid receptors. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GW405833 (CHEBI:92184) has role analgesic (CHEBI:35480) |
| GW405833 (CHEBI:92184) has role anti-inflammatory agent (CHEBI:67079) |
| GW405833 (CHEBI:92184) has role CB2 receptor agonist (CHEBI:146246) |
| GW405833 (CHEBI:92184) is a N-acylindole (CHEBI:75884) |
| GW405833 (CHEBI:92184) is a aromatic ether (CHEBI:35618) |
| GW405833 (CHEBI:92184) is a benzamides (CHEBI:22702) |
| GW405833 (CHEBI:92184) is a dichlorobenzene (CHEBI:23697) |
| GW405833 (CHEBI:92184) is a methylindole (CHEBI:38460) |
| GW405833 (CHEBI:92184) is a morpholines (CHEBI:38785) |
| IUPAC Name |
|---|
| (2,3-dichlorophenyl){5-methoxy-2-methyl-3-[2-(morpholin-4-yl)ethyl]-1H-indol-1-yl}methanone |
| Synonyms | Source |
|---|---|
| (2,3-dichlorophenyl)[5-methoxy-2-methyl-3-[2-(4-morpholinyl)ethyl]-1H-indol-1-yl]methanone | ChEBI |
| (2,3-dichlorophenyl)-[5-methoxy-2-methyl-3-[2-(4-morpholinyl)ethyl]-1-indolyl]methanone | ChEBI |
| (2,3-dichloro-phenyl)-[5-methoxy-2-methyl-3-(2-morpholin-4-yl-ethyl)-indol-1-yl]-methanone | ChEBI |
| GW 405833 | ChEBI |
| GW-405,833 | ChEBI |
| GW-405833 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| GW-405,833 | Wikipedia |
| LSM-2217 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:180002-83-9 | ChEBI |
| Citations |
|---|