EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H54O8 |
| Net Charge | 0 |
| Average Mass | 590.798 |
| Monoisotopic Mass | 590.38187 |
| SMILES | [H][C@]1([C@@H](CC)C(=O)[C@@H](C)[C@@H](O)[C@H](C)CCc2ccc(C)c(O)c2C(=O)O)O[C@](CC)([C@@]2([H])CC[C@](O)(CC)[C@H](C)O2)C[C@@H]1C |
| InChI | InChI=1S/C34H54O8/c1-9-25(31-21(6)18-34(11-3,42-31)26-16-17-33(40,10-2)23(8)41-26)30(37)22(7)28(35)19(4)12-14-24-15-13-20(5)29(36)27(24)32(38)39/h13,15,19,21-23,25-26,28,31,35-36,40H,9-12,14,16-18H2,1-8H3,(H,38,39)/t19-,21+,22+,23+,25+,26-,28+,31+,33-,34+/m1/s1 |
| InChIKey | BBMULGJBVDDDNI-OWKLGTHSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces lasalocidi (ncbitaxon:324833) | - | PubMed (32228806) | Strain: ATCC 31180T |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | coccidiostat An agent useful in the treatment or prevention of coccidiosis in man or animals. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. ionophore A compound which can carry specific ions through membranes of cells or organelles. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | coccidiostat An agent useful in the treatment or prevention of coccidiosis in man or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lasalocid (CHEBI:92181) has role bacterial metabolite (CHEBI:76969) |
| lasalocid (CHEBI:92181) has role coccidiostat (CHEBI:35818) |
| lasalocid (CHEBI:92181) has role ionophore (CHEBI:24869) |
| lasalocid (CHEBI:92181) is a monocarboxylic acid (CHEBI:25384) |
| lasalocid (CHEBI:92181) is a monohydroxybenzoic acid (CHEBI:25389) |
| lasalocid (CHEBI:92181) is a oxanes (CHEBI:46942) |
| lasalocid (CHEBI:92181) is a oxolanes (CHEBI:26912) |
| lasalocid (CHEBI:92181) is a polyether antibiotic (CHEBI:26179) |
| lasalocid (CHEBI:92181) is a secondary alcohol (CHEBI:35681) |
| lasalocid (CHEBI:92181) is a tertiary alcohol (CHEBI:26878) |
| lasalocid (CHEBI:92181) is a β-hydroxy ketone (CHEBI:55380) |
| lasalocid (CHEBI:92181) is conjugate acid of lasalocid(1−) (CHEBI:156364) |
| Incoming Relation(s) |
| lasalocid(1−) (CHEBI:156364) is conjugate base of lasalocid (CHEBI:92181) |
| IUPAC Name |
|---|
| (1S,9S)-1,5:6,9-dianhydro-9-[(3R,5S,6S,7R)-9-(2-carboxy-3-hydroxy-4-methylphenyl)-6-hydroxy-5,7-dimethyl-4-oxononan-3-yl]-3,4,7,8-tetradeoxy-6-ethyl-2-C-ethyl-1,8-dimethyl-D-galacto-nonitol |
| INNs | Source |
|---|---|
| lasalocid | WHO MedNet |
| lasalocide | WHO MedNet |
| lasalócido | WHO MedNet |
| lasalocidum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 6-[(3R,4S,5S,7R)-7-{(2S,3S,5S)-5-ethyl-5-[(2R,5R,6S)-5-ethyl-5-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]-3-methyltetrahydrofuran-2-yl}-4-hydroxy-3,5-dimethyl-6-oxononyl]-2-hydroxy-3-methylbenzoic acid | IUPAC |
| antibiotic X 537A | ChemIDplus |
| ionophore X 537A | ChemIDplus |
| lasalocid A | ChemIDplus |
| Ro 2-2985 | ChemIDplus |
| X 537A | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:25999-31-9 | ChemIDplus |
| Citations |
|---|