EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H54O8 |
| Net Charge | 0 |
| Average Mass | 590.798 |
| Monoisotopic Mass | 590.38187 |
| SMILES | [H][C@]1([C@@H](CC)C(=O)[C@@H](C)[C@@H](O)[C@H](C)CCc2ccc(C)c(O)c2C(=O)O)O[C@](CC)([C@@]2([H])CC[C@](O)(CC)[C@H](C)O2)C[C@@H]1C |
| InChI | InChI=1S/C34H54O8/c1-9-25(31-21(6)18-34(11-3,42-31)26-16-17-33(40,10-2)23(8)41-26)30(37)22(7)28(35)19(4)12-14-24-15-13-20(5)29(36)27(24)32(38)39/h13,15,19,21-23,25-26,28,31,35-36,40H,9-12,14,16-18H2,1-8H3,(H,38,39)/t19-,21+,22+,23+,25+,26-,28+,31+,33-,34+/m1/s1 |
| InChIKey | BBMULGJBVDDDNI-OWKLGTHSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces lasalocidi (ncbitaxon:324833) | - | PubMed (32228806) | Strain: ATCC 31180T |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | ionophore A compound which can carry specific ions through membranes of cells or organelles. coccidiostat An agent useful in the treatment or prevention of coccidiosis in man or animals. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | coccidiostat An agent useful in the treatment or prevention of coccidiosis in man or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lasalocid (CHEBI:92181) has role bacterial metabolite (CHEBI:76969) |
| lasalocid (CHEBI:92181) has role coccidiostat (CHEBI:35818) |
| lasalocid (CHEBI:92181) has role ionophore (CHEBI:24869) |
| lasalocid (CHEBI:92181) is a monocarboxylic acid (CHEBI:25384) |
| lasalocid (CHEBI:92181) is a monohydroxybenzoic acid (CHEBI:25389) |
| lasalocid (CHEBI:92181) is a oxanes (CHEBI:46942) |
| lasalocid (CHEBI:92181) is a oxolanes (CHEBI:26912) |
| lasalocid (CHEBI:92181) is a polyether antibiotic (CHEBI:26179) |
| lasalocid (CHEBI:92181) is a secondary alcohol (CHEBI:35681) |
| lasalocid (CHEBI:92181) is a tertiary alcohol (CHEBI:26878) |
| lasalocid (CHEBI:92181) is a β-hydroxy ketone (CHEBI:55380) |
| lasalocid (CHEBI:92181) is conjugate acid of lasalocid(1−) (CHEBI:156364) |
| Incoming Relation(s) |
| lasalocid(1−) (CHEBI:156364) is conjugate base of lasalocid (CHEBI:92181) |
| IUPAC Name |
|---|
| (1S,9S)-1,5:6,9-dianhydro-9-[(3R,5S,6S,7R)-9-(2-carboxy-3-hydroxy-4-methylphenyl)-6-hydroxy-5,7-dimethyl-4-oxononan-3-yl]-3,4,7,8-tetradeoxy-6-ethyl-2-C-ethyl-1,8-dimethyl-D-galacto-nonitol |
| INNs | Source |
|---|---|
| lasalócido | WHO MedNet |
| lasalocidum | WHO MedNet |
| lasalocide | WHO MedNet |
| lasalocid | WHO MedNet |
| Synonyms | Source |
|---|---|
| lasalocid A | ChemIDplus |
| antibiotic X 537A | ChemIDplus |
| ionophore X 537A | ChemIDplus |
| X-537A | ChEBI |
| Ro 2-2985 | ChemIDplus |
| X 537A | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:25999-31-9 | ChemIDplus |
| Citations |
|---|