EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H24N2O7.2HCl |
| Net Charge | 0 |
| Average Mass | 405.275 |
| Monoisotopic Mass | 404.11171 |
| SMILES | Cl.Cl.[H][C@]12O[C@@H]3[C@@H](O)[C@H](NC)[C@H](O)[C@H](NC)[C@H]3O[C@@]1(O)C(=O)C[C@@H](C)O2 |
| InChI | InChI=1S/C14H24N2O7.2ClH/c1-5-4-6(17)14(20)13(21-5)22-12-10(19)7(15-2)9(18)8(16-3)11(12)23-14;;/h5,7-13,15-16,18-20H,4H2,1-3H3;2*1H/t5-,7-,8+,9+,10+,11-,12-,13+,14+;;/m1../s1 |
| InChIKey | FOGDPGQSHLLYIK-XYQGXRRISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spectinomycin dihydrochloride (CHEBI:9216) has part spectinomycin(2+) (CHEBI:77315) |
| spectinomycin dihydrochloride (CHEBI:9216) has role antibacterial drug (CHEBI:36047) |
| spectinomycin dihydrochloride (CHEBI:9216) has role antimicrobial agent (CHEBI:33281) |
| spectinomycin dihydrochloride (CHEBI:9216) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| (2R,4aR,5aR,6S,7S,8R,9S,9aR,10aS)-4a,7,9-trihydroxy-2-methyl-6,8-bis(methylamino)decahydro-4H-pyrano[2,3-b][1,4]benzodioxin-4-one dihydrochloride |
| (2R,4aR,5aR,6S,7S,8R,9S,9aR,10aS)-4a,7,9-trihydroxy-N,N',2-trimethyl-4-oxodecahydro-2H-pyrano[2,3-b][1,4]benzodioxine-6,8-diaminium dichloride |
| Synonyms | Source |
|---|---|
| Spectinomycin dihydrochloride | KEGG COMPOUND |
| Spectinomycin HCl | ChemIDplus |
| Spectinomycin hydrochloride | ChemIDplus |
| Spectinomycin hydrochloride anhydrous | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11619 | KEGG COMPOUND |
| DB00919 | DrugBank |
| Spectinomycin | Wikipedia |
| US4203903 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10503301 | Reaxys |
| CAS:21736-83-4 | KEGG COMPOUND |
| CAS:21736-83-4 | ChemIDplus |
| Citations |
|---|