EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H24N2O7 |
| Net Charge | 0 |
| Average Mass | 332.353 |
| Monoisotopic Mass | 332.15835 |
| SMILES | [H][C@]12O[C@@H]3[C@@H](O)[C@H](NC)[C@H](O)[C@H](NC)[C@H]3O[C@@]1(O)C(=O)C[C@@H](C)O2 |
| InChI | InChI=1S/C14H24N2O7/c1-5-4-6(17)14(20)13(21-5)22-12-10(19)7(15-2)9(18)8(16-3)11(12)23-14/h5,7-13,15-16,18-20H,4H2,1-3H3/t5-,7-,8+,9+,10+,11-,12-,13+,14+/m1/s1 |
| InChIKey | UNFWWIHTNXNPBV-WXKVUWSESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spectinomycin (CHEBI:9215) has role antibacterial drug (CHEBI:36047) |
| spectinomycin (CHEBI:9215) has role antimicrobial agent (CHEBI:33281) |
| spectinomycin (CHEBI:9215) has role bacterial metabolite (CHEBI:76969) |
| spectinomycin (CHEBI:9215) is a cyclic acetal (CHEBI:59770) |
| spectinomycin (CHEBI:9215) is a cyclic hemiketal (CHEBI:59780) |
| spectinomycin (CHEBI:9215) is a cyclic ketone (CHEBI:3992) |
| spectinomycin (CHEBI:9215) is a pyranobenzodioxin (CHEBI:146295) |
| spectinomycin (CHEBI:9215) is a secondary alcohol (CHEBI:35681) |
| spectinomycin (CHEBI:9215) is a secondary amino compound (CHEBI:50995) |
| spectinomycin (CHEBI:9215) is conjugate base of spectinomycin(1+) (CHEBI:146260) |
| spectinomycin (CHEBI:9215) is conjugate base of spectinomycin(2+) (CHEBI:77315) |
| Incoming Relation(s) |
| spectinomycin(1+) (CHEBI:146260) is conjugate acid of spectinomycin (CHEBI:9215) |
| spectinomycin(2+) (CHEBI:77315) is conjugate acid of spectinomycin (CHEBI:9215) |
| IUPAC Name |
|---|
| (2R,4aR,5aR,6S,7S,8R,9S,9aR,10aS)-4a,7,9-trihydroxy-2-methyl-6,8-bis(methylamino)decahydro-4H-pyrano[2,3-b][1,4]benzodioxin-4-one |
| INNs | Source |
|---|---|
| espectinomicina | DrugBank |
| spectinomycin | KEGG DRUG |
| spectinomycine | DrugBank |
| spectinomycinum | DrugBank |
| Synonym | Source |
|---|---|
| Antibiotic 2233wp | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2468 | DrugCentral |
| C02078 | KEGG COMPOUND |
| D08526 | KEGG DRUG |
| DB00919 | DrugBank |
| HMDB0015055 | HMDB |
| LSM-5298 | LINCS |
| SCM | PDBeChem |
| Spectinomycin | Wikipedia |
| US4203903 | Patent |
| WO2005041984 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2171701 | Reaxys |
| CAS:1695-77-8 | ChemIDplus |
| CAS:1695-77-8 | KEGG COMPOUND |
| Citations |
|---|