EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22F2N4O3 |
| Net Charge | 0 |
| Average Mass | 392.406 |
| Monoisotopic Mass | 392.16600 |
| SMILES | C[C@@H]1CN(c2c(F)c(N)c3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)C[C@H](C)N1 |
| InChI | InChI=1S/C19H22F2N4O3/c1-8-5-24(6-9(2)23-8)17-13(20)15(22)12-16(14(17)21)25(10-3-4-10)7-11(18(12)26)19(27)28/h7-10,23H,3-6,22H2,1-2H3,(H,27,28)/t8-,9+ |
| InChIKey | DZZWHBIBMUVIIW-DTORHVGOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sparfloxacin (CHEBI:9212) is a N-arylpiperazine (CHEBI:46848) |
| sparfloxacin (CHEBI:9212) is a fluoroquinolone antibiotic (CHEBI:87211) |
| sparfloxacin (CHEBI:9212) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| sparfloxacin (CHEBI:9212) is a quinolone (CHEBI:23765) |
| sparfloxacin (CHEBI:9212) is a quinolone antibiotic (CHEBI:86324) |
| IUPAC Name |
|---|
| 5-amino-1-cyclopropyl-7-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6,8-difluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| Sparfloxacin | KEGG COMPOUND |
| cis-5-Amino-1-cyclopropyl-7-(3,5-dimethyl-1-piperazinyl)-6,8-difluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3658018 | Beilstein |
| CAS:110871-86-8 | KEGG COMPOUND |
| CAS:110871-86-8 | ChemIDplus |