EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12N2O2S |
| Net Charge | 0 |
| Average Mass | 284.340 |
| Monoisotopic Mass | 284.06195 |
| SMILES | Cc1ccc(NC2=CC(=O)c3sc(C)nc3C2=O)cc1 |
| InChI | InChI=1S/C15H12N2O2S/c1-8-3-5-10(6-4-8)17-11-7-12(18)15-13(14(11)19)16-9(2)20-15/h3-7,17H,1-2H3 |
| InChIKey | HFPLHASLIOXVGS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ryuvidine (CHEBI:92119) has role antineoplastic agent (CHEBI:35610) |
| ryuvidine (CHEBI:92119) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| ryuvidine (CHEBI:92119) is a p-quinones (CHEBI:25830) |
| ryuvidine (CHEBI:92119) is a aminotoluene (CHEBI:22531) |
| ryuvidine (CHEBI:92119) is a benzothiazoles (CHEBI:37947) |
| ryuvidine (CHEBI:92119) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 2-methyl-5-(4-methylanilino)-1,3-benzothiazole-4,7-dione |
| Synonyms | Source |
|---|---|
| 2-methyl-5-[(4-methylphenyl)amino]-4,7-benzothiazoledione | ChEBI |
| 5-(N-(4-methylphenyl)amino)-2-methyl-4,7-dioxobenzothiazole | ChEBI |
| Cdk4 Inhibitor III | ChEBI |
| cyclic-dependent kinase 4 inhibitor III | ChEBI |
| SPS812 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-2121 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:265312-55-8 | ChEBI |
| Citations |
|---|