EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H78O18 |
| Net Charge | 0 |
| Average Mass | 943.134 |
| Monoisotopic Mass | 942.51882 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)C[C@@H](O)[C@]4(C)CC[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)CC[C@H](O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)[C@]1(C)CO |
| InChI | InChI=1S/C48H78O18/c1-21-29(52)31(54)35(58)40(61-21)65-37-32(55)30(53)24(19-49)62-41(37)66-38-34(57)33(56)36(39(59)60)64-42(38)63-28-12-13-45(5)25(46(28,6)20-50)11-14-48(8)26(45)10-9-22-23-17-43(2,3)18-27(51)44(23,4)15-16-47(22,48)7/h9,21,23-38,40-42,49-58H,10-20H2,1-8H3,(H,59,60)/t21-,23-,24+,25+,26+,27+,28-,29-,30-,31+,32-,33-,34-,35+,36-,37+,38+,40-,41-,42+,44+,45-,46+,47+,48+/m0/s1 |
| InChIKey | PTDAHAWQAGSZDD-IOVCITQVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Medicago truncatula (ncbitaxon:3880) | root (BTO:0001188) | PubMed (21615146) | MeOH extract of frozen and grounded hairy roots |
| Roles Classification |
|---|
| Biological Roles: | sialyltransferase inhibitor An EC 2.4.99.* (glycosyltransferases transferring other glycosyl groups) inhibitor that interferes with the action of a sialyltransferase. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| soyasaponin I (CHEBI:9211) has functional parent soyasapogenol B (CHEBI:9209) |
| soyasaponin I (CHEBI:9211) has role sialyltransferase inhibitor (CHEBI:62915) |
| soyasaponin I (CHEBI:9211) is a carbohydrate acid derivative (CHEBI:63436) |
| soyasaponin I (CHEBI:9211) is a pentacyclic triterpenoid (CHEBI:25872) |
| soyasaponin I (CHEBI:9211) is a trisaccharide derivative (CHEBI:63571) |
| soyasaponin I (CHEBI:9211) is a triterpenoid saponin (CHEBI:61778) |
| soyasaponin I (CHEBI:9211) is conjugate acid of soyasaponin I(1−) (CHEBI:62916) |
| Incoming Relation(s) |
| soyasaponin I(1−) (CHEBI:62916) is conjugate base of soyasaponin I (CHEBI:9211) |
| IUPAC Name |
|---|
| (3β,22β)-22,24-dihydroxyolean-12-en-3-yl 6-deoxy-α-L-mannopyranosyl-(1→2)-β-D-galactopyranosyl-(1→2)-β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| (3β,22β)-22,24-dihydroxyolean-12-en-3-yl α-L-rhamnopyranosyl-(1→2)-β-D-galactopyranosyl-(1→2)-β-D-glucopyranosiduronic acid | IUPAC |
| soyasaponin 1 | ChEBI |
| soyasaponin Bb | ChEBI |
| Soyasaponin I | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00003553 | KNApSAcK |
| C08983 | KEGG COMPOUND |
| CPD-13255 | MetaCyc |
| JP2010018552 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5375730 | Reaxys |
| CAS:51330-27-9 | ChemIDplus |
| CAS:51330-27-9 | KEGG COMPOUND |
| Citations |
|---|