EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16N2O3 |
| Net Charge | 0 |
| Average Mass | 308.337 |
| Monoisotopic Mass | 308.11609 |
| SMILES | CN(C(=O)c1c(O)c2ccccc2n(C)c1=O)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O3/c1-19(12-8-4-3-5-9-12)17(22)15-16(21)13-10-6-7-11-14(13)20(2)18(15)23/h3-11,21H,1-2H3 |
| InChIKey | SGOOQMRIPALTEL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-N,1-dimethyl-2-oxo-N-phenyl-3-quinolinecarboxamide (CHEBI:92056) has role antineoplastic agent (CHEBI:35610) |
| 4-hydroxy-N,1-dimethyl-2-oxo-N-phenyl-3-quinolinecarboxamide (CHEBI:92056) is a aromatic amide (CHEBI:62733) |
| Synonyms | Source |
|---|---|
| FCF 89 | ChEMBL |
| FCF-89 | ChEMBL |
| linomide | DrugCentral |
| LS 2616 | ChEMBL |
| LS-2616 | DrugCentral |
| roquinimex | ChEMBL |
| Citations |
|---|