EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9205 - Sorgolactone
| Formula | C18H20O5 |
| Net Charge | 0 |
| Average Mass | 316.353 |
| Monoisotopic Mass | 316.13107 |
| SMILES | [H][C@]1(O/C=C2/C(=O)O[C@]3([H])C4=C(CCC[C@@H]4C)C[C@]23[H])C=C(C)C(=O)O1 |
| InChI | InChI=1S/C18H20O5/c1-9-4-3-5-11-7-12-13(18(20)23-16(12)15(9)11)8-21-14-6-10(2)17(19)22-14/h6,8-9,12,14,16H,3-5,7H2,1-2H3/b13-8+/t9-,12+,14+,16-/m0/s1 |
| InChIKey | KHSREFIWULNDAB-YCUBLIQYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sorgolactone (CHEBI:9205) is a indenofuran (CHEBI:149453) |
| Sorgolactone (CHEBI:9205) is a strigolactone (CHEBI:68487) |
| Synonym | Source |
|---|---|
| Sorgolactone | KEGG COMPOUND |