EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO |
| Net Charge | 0 |
| Average Mass | 141.214 |
| Monoisotopic Mass | 141.11536 |
| SMILES | [H][C@@]1(CC(C)=O)CCCN1C |
| InChI | InChI=1S/C8H15NO/c1-7(10)6-8-4-3-5-9(8)2/h8H,3-6H2,1-2H3/t8-/m0/s1 |
| InChIKey | ADKXZIOQKHHDNQ-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-hygrine (CHEBI:92) is a 1-(1-methylpyrrolidin-2-yl)acetone (CHEBI:84448) |
| (−)-hygrine (CHEBI:92) is a pyrrolidine alkaloid (CHEBI:26456) |
| (−)-hygrine (CHEBI:92) is enantiomer of hygrine (CHEBI:46750) |
| Incoming Relation(s) |
| rac-hygrine (CHEBI:84449) has part (−)-hygrine (CHEBI:92) |
| hygrine (CHEBI:46750) is enantiomer of (−)-hygrine (CHEBI:92) |
| IUPAC Name |
|---|
| 1-[(2S)-1-methylpyrrolidin-2-yl]propan-2-one |
| Synonyms | Source |
|---|---|
| (-)-Hygrine | KEGG COMPOUND |
| (S)-hygrine | ChEBI |
| 1-[(2S)-1-methylpyrrolidin-2-yl]acetone | ChEBI |
| Citations |
|---|