EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H36O4 |
| Net Charge | 0 |
| Average Mass | 460.614 |
| Monoisotopic Mass | 460.26136 |
| SMILES | CC(C)=CCc1cc([C@@H]2CC(=O)c3ccc(O)c(CC=C(C)C)c3O2)cc(CC=C(C)C)c1O |
| InChI | InChI=1S/C30H36O4/c1-18(2)7-10-21-15-23(16-22(29(21)33)11-8-19(3)4)28-17-27(32)25-13-14-26(31)24(30(25)34-28)12-9-20(5)6/h7-9,13-16,28,31,33H,10-12,17H2,1-6H3/t28-/m0/s1 |
| InChIKey | IORSRBKNYXPSDO-NDEPHWFRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sophora tonkinensis (ncbitaxon:714503) | - | PubMed (24345512) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sophoranone (CHEBI:9199) has functional parent (2S)-flavanone (CHEBI:15606) |
| sophoranone (CHEBI:9199) has role plant metabolite (CHEBI:76924) |
| sophoranone (CHEBI:9199) is a 4'-hydroxyflavanones (CHEBI:140331) |
| sophoranone (CHEBI:9199) is a dihydroxyflavanone (CHEBI:38749) |
| Synonym | Source |
|---|---|
| (2S)-7-hydroxy-2-[4-hydroxy-3,5-bis(3-methylbut-2-en-1-yl)phenyl]-8-(3-methylbut-2-en-1-yl)-2,3-dihydro-4H-1-benzopyran-4-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08719 | KEGG COMPOUND |
| C00001005 | KNApSAcK |
| LMPK12140034 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1332986 | Reaxys |
| CAS:23057-55-8 | KEGG COMPOUND |
| Citations |
|---|