EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23ClO5 |
| Net Charge | 0 |
| Average Mass | 402.874 |
| Monoisotopic Mass | 402.12340 |
| SMILES | O=C(O)CCC=CCC1COC(c2ccccc2Cl)OC1c1ccccc1O |
| InChI | InChI=1S/C22H23ClO5/c23-18-11-6-4-9-16(18)22-27-14-15(8-2-1-3-13-20(25)26)21(28-22)17-10-5-7-12-19(17)24/h1-2,4-7,9-12,15,21-22,24H,3,8,13-14H2,(H,25,26) |
| InChIKey | WHUIENZXNGAHQI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-[2-(2-chlorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]-4-hexenoic acid (CHEBI:91944) is a medium-chain fatty acid (CHEBI:59554) |
| Manual Xrefs | Databases |
|---|---|
| LSM-1887 | LINCS |