EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H43NO2 |
| Net Charge | 0 |
| Average Mass | 413.646 |
| Monoisotopic Mass | 413.32938 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])O[C@]3(CC[C@@H](C)CN3)[C@@H](C)[C@]12[H] |
| InChI | InChI=1S/C27H43NO2/c1-16-7-12-27(28-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(29)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28-29H,6-15H2,1-4H3/t16-,17+,19+,20-,21+,22+,23+,24+,25+,26+,27-/m1/s1 |
| InChIKey | KWVISVAMQJWJSZ-VKROHFNGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | diuretic An agent that promotes the excretion of urine through its effects on kidney function. anticonvulsant A drug used to prevent seizures or reduce their severity. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. antispermatogenic agent An agent that destroy spermatozoa in the male genitalia and block spermatogenesis. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| solasodine (CHEBI:9190) has role anticonvulsant (CHEBI:35623) |
| solasodine (CHEBI:9190) has role antifungal agent (CHEBI:35718) |
| solasodine (CHEBI:9190) has role antiinfective agent (CHEBI:35441) |
| solasodine (CHEBI:9190) has role antioxidant (CHEBI:22586) |
| solasodine (CHEBI:9190) has role antipyretic (CHEBI:35493) |
| solasodine (CHEBI:9190) has role antispermatogenic agent (CHEBI:145047) |
| solasodine (CHEBI:9190) has role apoptosis inducer (CHEBI:68495) |
| solasodine (CHEBI:9190) has role cardiotonic drug (CHEBI:38147) |
| solasodine (CHEBI:9190) has role central nervous system depressant (CHEBI:35488) |
| solasodine (CHEBI:9190) has role diuretic (CHEBI:35498) |
| solasodine (CHEBI:9190) has role immunomodulator (CHEBI:50846) |
| solasodine (CHEBI:9190) has role plant metabolite (CHEBI:76924) |
| solasodine (CHEBI:9190) has role teratogenic agent (CHEBI:50905) |
| solasodine (CHEBI:9190) is a alkaloid antibiotic (CHEBI:86322) |
| solasodine (CHEBI:9190) is a azaspiro compound (CHEBI:35624) |
| solasodine (CHEBI:9190) is a hemiaminal ether (CHEBI:141498) |
| solasodine (CHEBI:9190) is a oxaspiro compound (CHEBI:37948) |
| solasodine (CHEBI:9190) is a sapogenin (CHEBI:26606) |
| solasodine (CHEBI:9190) is a steroid alkaloid (CHEBI:26767) |
| solasodine (CHEBI:9190) is conjugate base of solasodine(1+) (CHEBI:145043) |
| Incoming Relation(s) |
| solasodine 3-β-D-glucoside (CHEBI:229720) has functional parent solasodine (CHEBI:9190) |
| solasodine(1+) (CHEBI:145043) is conjugate acid of solasodine (CHEBI:9190) |
| IUPAC Name |
|---|
| (25R)-22α-spirosol-5-en-3β-ol |
| Synonyms | Source |
|---|---|
| (2S,2'R,4aR,4bS,5'R,6aS,6bR,7S,9aS,10aS,10bS)-4a,5',6a,7-tetramethyl-1,2,3,4,4a,4b,5,6,6a,6b,7,9a,10,10a,10b,11-hexadecahydrospiro[naphtho[2',1':4,5]indeno[2,1-b]furan-8,2'-piperidin]-2-ol | IUPAC |
| (3β,22α,25R)-spirosol-5-en-3-ol | ChemIDplus |
| purapuridine | ChemIDplus |
| solasod-5-en-3β-ol | ChemIDplus |
| solasod-5-en-3β-ol | NIST Chemistry WebBook |
| spiro[8H-naphth[2',1':4,5]indeno[2,1-b]furan-8,2'-piperidine] | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C00002264 | KNApSAcK |
| C10822 | KEGG COMPOUND |
| CPD-13080 | MetaCyc |
| FDB013944 | FooDB |
| HMDB0035282 | HMDB |
| LSM-6427 | LINCS |
| Solasodine | Wikipedia |
| Citations |
|---|