EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H40BrN5O5 |
| Net Charge | 0 |
| Average Mass | 654.606 |
| Monoisotopic Mass | 653.22128 |
| SMILES | CC(C)CC1C(=O)N2CCC[C@H]2C2(O)O[C@](NC(=O)C3C=C4c5cccc6nc(Br)c(c56)C[C@H]4N(C)C3)(C(C)C)C(=O)N12 |
| InChI | InChI=1S/C32H40BrN5O5/c1-16(2)12-24-29(40)37-11-7-10-25(37)32(42)38(24)30(41)31(43-32,17(3)4)35-28(39)18-13-20-19-8-6-9-22-26(19)21(27(33)34-22)14-23(20)36(5)15-18/h6,8-9,13,16-18,23-25,34,42H,7,10-12,14-15H2,1-5H3,(H,35,39)/t18?,23-,24?,25+,31-,32?/m1/s1 |
| InChIKey | OZVBMTJYIDMWIL-NXIPCUEUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-1817 (CHEBI:91882) is a peptide ergot alkaloid (CHEBI:25904) |
| Manual Xrefs | Databases |
|---|---|
| LSM-1817 | LINCS |