EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H53O8.Na |
| Net Charge | 0 |
| Average Mass | 612.780 |
| Monoisotopic Mass | 612.36381 |
| SMILES | [H][C@]1([C@@H](CC)C(=O)[C@@H](C)[C@@H](O)[C@H](C)CCc2ccc(C)c(O)c2C(=O)[O-])O[C@](CC)([C@@]2([H])CC[C@](O)(CC)[C@H](C)O2)C[C@@H]1C.[Na+] |
| InChI | InChI=1S/C34H54O8.Na/c1-9-25(31-21(6)18-34(11-3,42-31)26-16-17-33(40,10-2)23(8)41-26)30(37)22(7)28(35)19(4)12-14-24-15-13-20(5)29(36)27(24)32(38)39;/h13,15,19,21-23,25-26,28,31,35-36,40H,9-12,14,16-18H2,1-8H3,(H,38,39);/q;+1/p-1/t19-,21+,22+,23+,25+,26-,28+,31+,33-,34+;/m1./s1 |
| InChIKey | RDHDUYAKDYQPEW-HWLWSTNVSA-M |
| Roles Classification |
|---|
| Biological Roles: | coccidiostat An agent useful in the treatment or prevention of coccidiosis in man or animals. ionophore A compound which can carry specific ions through membranes of cells or organelles. |
| Application: | coccidiostat An agent useful in the treatment or prevention of coccidiosis in man or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lasalocid sodium (CHEBI:91848) has part lasalocid(1−) (CHEBI:156364) |
| lasalocid sodium (CHEBI:91848) has role coccidiostat (CHEBI:35818) |
| lasalocid sodium (CHEBI:91848) has role ionophore (CHEBI:24869) |
| lasalocid sodium (CHEBI:91848) is a benzoates (CHEBI:22718) |
| lasalocid sodium (CHEBI:91848) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium (1S,9S)-1,5:6,9-dianhydro-9-[(3R,5S,6S,7R)-9-(2-carboxylato-3-hydroxy-4-methylphenyl)-6-hydroxy-5,7-dimethyl-4-oxononan-3-yl]-3,4,7,8-tetradeoxy-6-ethyl-2-C-ethyl-1,8-dimethyl-D-galacto-nonitol |
| Synonyms | Source |
|---|---|
| lasalocid A monosodium salt | ChemIDplus |
| lasalocid A sodium | ChEBI |
| lasalocid A sodium salt | ChEBI |
| lasalocid-Na | ChEBI |
| lasalocid sodium salt | ChemIDplus |
| MT 2007 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Avatec | ChemIDplus |
| Bovatec | ChemIDplus |
| Bovatec 150FP | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-1767 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:25999-20-6 | ChemIDplus |
| Citations |
|---|