EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48N2O2 |
| Net Charge | 0 |
| Average Mass | 432.693 |
| Monoisotopic Mass | 432.37158 |
| SMILES | [H][C@]1([C@@H](C)[C@@]2([H])[C@H](O)C[C@@]3([H])[C@]4([H])CC[C@@]5([H])C[C@@H](N)CC[C@]5(C)[C@@]4([H])CC[C@]23C)NC[C@H](C)C[C@@H]1O |
| InChI | InChI=1S/C27H48N2O2/c1-15-11-23(31)25(29-14-15)16(2)24-22(30)13-21-19-6-5-17-12-18(28)7-9-26(17,3)20(19)8-10-27(21,24)4/h15-25,29-31H,5-14,28H2,1-4H3/t15-,16+,17+,18+,19-,20+,21+,22-,23+,24+,25-,26+,27+/m1/s1 |
| InChIKey | SSDNUGHQUZHHEE-YGUMODFPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Solacapine (CHEBI:9184) is a steroid alkaloid (CHEBI:26767) |
| Synonym | Source |
|---|---|
| Solacapine | KEGG COMPOUND |