EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20N2O3S |
| Net Charge | 0 |
| Average Mass | 284.381 |
| Monoisotopic Mass | 284.11946 |
| SMILES | CCCNC(C)C(=O)Nc1c(C)csc1C(=O)OC |
| InChI | InChI=1S/C13H20N2O3S/c1-5-6-14-9(3)12(16)15-10-8(2)7-19-11(10)13(17)18-4/h7,9,14H,5-6H2,1-4H3,(H,15,16) |
| InChIKey | QTGIAADRBBLJGA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methyl-3-[[1-oxo-2-(propylamino)propyl]amino]-2-thiophenecarboxylic acid methyl ester (CHEBI:91834) is a thiophenecarboxylic acid (CHEBI:48436) |
| Synonyms | Source |
|---|---|
| articaine HCl | DrugCentral |
| articaine hydrochloride | DrugCentral |
| carticaine | DrugCentral |