EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N3O2 |
| Net Charge | 0 |
| Average Mass | 339.439 |
| Monoisotopic Mass | 339.19468 |
| SMILES | CCC(CO)NC(=O)C1C=C2c3cccc4ncc(c34)CC2N(C)C1 |
| InChI | InChI=1S/C20H25N3O2/c1-3-14(11-24)22-20(25)13-7-16-15-5-4-6-17-19(15)12(9-21-17)8-18(16)23(2)10-13/h4-7,9,13-14,18,21,24H,3,8,10-11H2,1-2H3,(H,22,25) |
| InChIKey | UNBRKDKAWYKMIV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(1-hydroxybutan-2-yl)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (CHEBI:91798) is a ergoline alkaloid (CHEBI:60529) |
| Manual Xrefs | Databases |
|---|---|
| LSM-1695 | LINCS |