EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H37N5O2 |
| Net Charge | 0 |
| Average Mass | 451.615 |
| Monoisotopic Mass | 451.29473 |
| SMILES | C=CCN1CC(C(=O)N(CCCN(C)C)C(=O)NCC)CC2c3cccc4ncc(c34)CC21 |
| InChI | InChI=1S/C26H37N5O2/c1-5-11-30-17-19(25(32)31(26(33)27-6-2)13-8-12-29(3)4)14-21-20-9-7-10-22-24(20)18(16-28-22)15-23(21)30/h5,7,9-10,16,19,21,23,28H,1,6,8,11-15,17H2,2-4H3,(H,27,33) |
| InChIKey | KORNTPPJEAJQIU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[3-(dimethylamino)propyl]-N-(ethylcarbamoyl)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (CHEBI:91795) is a ergoline alkaloid (CHEBI:60529) |
| Manual Xrefs | Databases |
|---|---|
| LSM-1692 | LINCS |