EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO4 |
| Net Charge | 0 |
| Average Mass | 303.358 |
| Monoisotopic Mass | 303.14706 |
| SMILES | CN1C2CC(OC(=O)[C@H](CO)c3ccccc3)C[C@H]1[C@H]1OC21 |
| InChI | InChI=1S/C17H21NO4/c1-18-13-7-11(8-14(18)16-15(13)22-16)21-17(20)12(9-19)10-5-3-2-4-6-10/h2-6,11-16,19H,7-9H2,1H3/t11?,12-,13+,14?,15-,16?/m1/s1 |
| InChIKey | STECJAGHUSJQJN-OGWGVHNISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-1684 (CHEBI:91789) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| Manual Xrefs | Databases |
|---|---|
| LSM-1684 | LINCS |