EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15N3O6 |
| Net Charge | 0 |
| Average Mass | 333.300 |
| Monoisotopic Mass | 333.09609 |
| SMILES | NC(Cn1ccc(=O)n(Cc2ccccc2C(=O)O)c1=O)C(=O)O |
| InChI | InChI=1S/C15H15N3O6/c16-11(14(22)23)8-17-6-5-12(19)18(15(17)24)7-9-3-1-2-4-10(9)13(20)21/h1-6,11H,7-8,16H2,(H,20,21)(H,22,23) |
| InChIKey | UUIYULWYHDSXHL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[3-(2-amino-2-carboxyethyl)-2,6-dioxo-1-pyrimidinyl]methyl]benzoic acid (CHEBI:91719) is a α-amino acid (CHEBI:33704) |
| Manual Xrefs | Databases |
|---|---|
| LSM-1574 | LINCS |