EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H45NO3 |
| Net Charge | 0 |
| Average Mass | 431.661 |
| Monoisotopic Mass | 431.33994 |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NC(CO)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C27H45NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-27(31)28-25(23-29)22-24-18-20-26(30)21-19-24/h9-10,18-21,25,29-30H,2-8,11-17,22-23H2,1H3,(H,28,31) |
| InChIKey | ICDMLAQPOAVWNH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]-9-octadecenamide (CHEBI:91680) is a amphetamines (CHEBI:35338) |
| Manual Xrefs | Databases |
|---|---|
| LSM-1521 | LINCS |