EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13ClN2 |
| Net Charge | 0 |
| Average Mass | 208.692 |
| Monoisotopic Mass | 208.07673 |
| SMILES | Clc1ccc(C2CC3CCC2N3)cn1 |
| InChI | InChI=1S/C11H13ClN2/c12-11-4-1-7(6-13-11)9-5-8-2-3-10(9)14-8/h1,4,6,8-10,14H,2-3,5H2 |
| InChIKey | NLPRAJRHRHZCQQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane (CHEBI:91678) is a alkaloid (CHEBI:22315) |
| Manual Xrefs | Databases |
|---|---|
| LSM-1518 | LINCS |