EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16NO9S2 |
| Net Charge | -1 |
| Average Mass | 358.370 |
| Monoisotopic Mass | 358.02720 |
| SMILES | C=CC/C(=N/OS(=O)(=O)[O-])S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H17NO9S2/c1-2-3-6(11-20-22(16,17)18)21-10-9(15)8(14)7(13)5(4-12)19-10/h2,5,7-10,12-15H,1,3-4H2,(H,16,17,18)/p-1/b11-6-/t5-,7-,8+,9-,10+/m1/s1 |
| InChIKey | PHZOWSSBXJXFOR-GLVDENFASA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica oleracea (ncbitaxon:3712) | - | PubMed (24128451) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sinigrin(1−) (CHEBI:9162) is a (Z)-glucosinolate(1−) (CHEBI:183098) |
| sinigrin(1−) (CHEBI:9162) is a alkenylglucosinolate (CHEBI:36451) |
| sinigrin(1−) (CHEBI:9162) is conjugate base of sinigrin (CHEBI:79317) |
| Incoming Relation(s) |
| (Z)-N-(sulfonatooxy)prop-2-enimidothioate (CHEBI:183062) has functional parent sinigrin(1−) (CHEBI:9162) |
| sinigrin (CHEBI:79317) is conjugate acid of sinigrin(1−) (CHEBI:9162) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-N-(sulfonatooxy)but-3-enimidoyl]-1-thio-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 1-S-[N-(sulfonatooxy)but-3-enimidoyl]-1-thio-β-D-glucopyranose | IUPAC |
| allylglucosinolate | ChEBI |
| Sinigrin | KEGG COMPOUND |
| sinigrin anion | ChEBI |
| UniProt Name | Source |
|---|---|
| sinigrin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C08427 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1407048 | Reaxys |
| CAS:3952-98-5 | KEGG COMPOUND |