EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O7 |
| Net Charge | 0 |
| Average Mass | 372.373 |
| Monoisotopic Mass | 372.12090 |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)c(OC)c(OC)cc3o2)cc1OC |
| InChI | InChI=1S/C20H20O7/c1-22-13-7-6-11(8-15(13)23-2)14-9-12(21)18-16(27-14)10-17(24-3)19(25-4)20(18)26-5/h6-10H,1-5H3 |
| InChIKey | LKMNXYDUQXAUCZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sinensetin (CHEBI:9159) has functional parent flavone (CHEBI:42491) |
| sinensetin (CHEBI:9159) has role plant metabolite (CHEBI:76924) |
| sinensetin (CHEBI:9159) is a pentamethoxyflavone (CHEBI:38724) |
| IUPAC Name |
|---|
| 2-(3,4-dimethoxyphenyl)-5,6,7-trimethoxy-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 5,6,7,3',4'-Pentamethoxyflavone | KEGG COMPOUND |
| Pedalitin permethyl ether | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C00013596 | KNApSAcK |
| C10186 | KEGG COMPOUND |
| HMDB0036633 | HMDB |
| LMPK12111250 | LIPID MAPS |
| LSM-3903 | LINCS |
| Sinensetin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:345748 | Reaxys |
| CAS:2306-27-6 | KEGG COMPOUND |
| CAS:2306-27-6 | ChemIDplus |
| Citations |
|---|