EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NO5 |
| Net Charge | 0 |
| Average Mass | 331.368 |
| Monoisotopic Mass | 331.14197 |
| SMILES | COc1c2c(cc3c1OCO3)C13C=C[C@H](OC)CC1N(C2)CC3O |
| InChI | InChI=1S/C18H21NO5/c1-21-10-3-4-18-12-6-13-17(24-9-23-13)16(22-2)11(12)7-19(8-15(18)20)14(18)5-10/h3-4,6,10,14-15,20H,5,7-9H2,1-2H3/t10-,14?,15?,18?/m0/s1 |
| InChIKey | QAHZAHIPKNLGAS-UVJOJOKMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-1309 (CHEBI:91523) is a alkaloid (CHEBI:22315) |
| Manual Xrefs | Databases |
|---|---|
| LSM-1309 | LINCS |