EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H35NO5 |
| Net Charge | 0 |
| Average Mass | 429.557 |
| Monoisotopic Mass | 429.25152 |
| SMILES | CCN(CCCCOC(=O)c1ccc(OC)c(OC)c1)C(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H35NO5/c1-6-26(19(2)17-20-9-12-22(28-3)13-10-20)15-7-8-16-31-25(27)21-11-14-23(29-4)24(18-21)30-5/h9-14,18-19H,6-8,15-17H2,1-5H3 |
| InChIKey | VYVKHNNGDFVQGA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dimethoxybenzoic acid 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butyl ester (CHEBI:91514) is a methoxybenzoic acid (CHEBI:25238) |
| Synonyms | Source |
|---|---|
| CSAG 144 | DrugCentral |
| mebeverine HCl | DrugCentral |
| mebeverine hydrochloride | DrugCentral |