EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NO4 |
| Net Charge | 0 |
| Average Mass | 315.369 |
| Monoisotopic Mass | 315.14706 |
| SMILES | COC1=CC23CCCN2CCc2cc4c(cc2C3C1O)OCO4 |
| InChI | InChI=1S/C18H21NO4/c1-21-15-9-18-4-2-5-19(18)6-3-11-7-13-14(23-10-22-13)8-12(11)16(18)17(15)20/h7-9,16-17,20H,2-6,10H2,1H3 |
| InChIKey | YMNCVRSYJBNGLD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-1290 (CHEBI:91512) is a benzazepine alkaloid (CHEBI:38523) |
| LSM-1290 (CHEBI:91512) is a cyclic acetal (CHEBI:59770) |
| Manual Xrefs | Databases |
|---|---|
| LSM-1290 | LINCS |